C15H18Br2Cl2O2 — CID 162877187
3-bromo-6-(3-bromopropa-1,2-dienyl)-8,9-dichloro-2-ethenyl-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocine (PubChem CID 162877187) has the molecular formula C15H18Br2Cl2O2 and a molecular weight of 461.02 g/mol. Its IUPAC name is 3-bromo-6-(3-bromopropa-1,2-dienyl)-8,9-dichloro-2-ethenyl-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocine.
| Compound Name | 3-bromo-6-(3-bromopropa-1,2-dienyl)-8,9-dichloro-2-ethenyl-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocine |
|---|---|
| PubChem CID | 162877187 |
| Molecular Formula | C15H18Br2Cl2O2 |
| Molecular Weight | 461.02 g/mol |
| Exact Mass | 457.91 |
| IUPAC Name | 3-bromo-6-(3-bromopropa-1,2-dienyl)-8,9-dichloro-2-ethenyl-2,3,4,4a,6,7,8,9,10,10a-decahydropyrano[3,2-b]oxocine |
| SMILES | C=CC1OC2CC(Cl)C(Cl)CC(C=C=CBr)OC2CC1Br |
| InChI | InChI=1S/C15H18Br2Cl2O2/c1-2-13-10(17)7-14-15(21-13)8-12(19)11(18)6-9(20-14)4-3-5-16/h2,4-5,9-15H,1,6-8H2 |
| InChIKey | UFZDDXDVCLTXED-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|