C21H30O5 — CID 162877578
[(8S,9R,10S)-9-acetyloxy-10-hydroxyheptadec-1-en-11,13-diyn-8-yl] acetate (PubChem CID 162877578) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(8S,9R,10S)-9-acetyloxy-10-hydroxyheptadec-1-en-11,13-diyn-8-yl] acetate.
| Compound Name | [(8S,9R,10S)-9-acetyloxy-10-hydroxyheptadec-1-en-11,13-diyn-8-yl] acetate |
|---|---|
| PubChem CID | 162877578 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(8S,9R,10S)-9-acetyloxy-10-hydroxyheptadec-1-en-11,13-diyn-8-yl] acetate |
| SMILES | C=CCCCCC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](O)C#CC#CCCC |
| InChI | InChI=1S/C21H30O5/c1-5-7-9-11-13-15-19(24)21(26-18(4)23)20(25-17(3)22)16-14-12-10-8-6-2/h6,19-21,24H,2,5,7-8,10,12,14,16H2,1,3-4H3/t19-,20-,21+/m0/s1 |
| InChIKey | LUEUCGBCZCDGBX-PCCBWWKXSA-N |
| XLogP | 3.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|