C21H24O5 — CID 162877591
(1S,2S)-1-[(1S)-1-hydroxy-3-(4-hydroxyphenyl)prop-2-enyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 162877591) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1S,2S)-1-[(1S)-1-hydroxy-3-(4-hydroxyphenyl)prop-2-enyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (1S,2S)-1-[(1S)-1-hydroxy-3-(4-hydroxyphenyl)prop-2-enyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 162877591 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1S,2S)-1-[(1S)-1-hydroxy-3-(4-hydroxyphenyl)prop-2-enyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc2c(cc1OC)[C@H]([C@@H](O)C=Cc1ccc(O)cc1)[C@@H](O)CC2 |
| InChI | InChI=1S/C21H24O5/c1-25-19-11-14-6-10-18(24)21(16(14)12-20(19)26-2)17(23)9-5-13-3-7-15(22)8-4-13/h3-5,7-9,11-12,17-18,21-24H,6,10H2,1-2H3/t17-,18-,21+/m0/s1 |
| InChIKey | KAYRJPGARKNUEX-BBTUJRGHSA-N |
| XLogP | 2.87 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |