C23H38O13 — CID 162877746
[(2R,3S,4R,5R,6R)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxycyclohexyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 162877746) has the molecular formula C23H38O13 and a molecular weight of 522.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxycyclohexyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxycyclohexyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162877746 |
| Molecular Formula | C23H38O13 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-6-[[5,7-dihydroxy-2-(3,4,5-trihydroxycyclohexyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC2CC3C(O)CC(O)CC3OC2C2CC(O)C(O)C(O)C2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H38O13/c1-8(24)33-7-17-19(30)20(31)21(32)23(36-17)35-16-6-11-12(26)4-10(25)5-15(11)34-22(16)9-2-13(27)18(29)14(28)3-9/h9-23,25-32H,2-7H2,1H3/t9?,10?,11?,12?,13?,14?,15?,16?,17-,18?,19-,20-,21-,22?,23-/m1/s1 |
| InChIKey | XQSOMWNVIGKPSE-WAJUMZNVSA-N |
| XLogP | -3.48 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |