C15H24O2 — CID 162877820
(1R,2R,4E,8E,11S)-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-2-ol (PubChem CID 162877820) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2R,4E,8E,11S)-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-2-ol.
| Compound Name | (1R,2R,4E,8E,11S)-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-2-ol |
|---|---|
| PubChem CID | 162877820 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2R,4E,8E,11S)-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodeca-4,8-dien-2-ol |
| SMILES | C/C1=C\CC(C)(C)/C=C/C[C@]2(C)O[C@@H]2[C@H](O)C1 |
| InChI | InChI=1S/C15H24O2/c1-11-6-9-14(2,3)7-5-8-15(4)13(17-15)12(16)10-11/h5-7,12-13,16H,8-10H2,1-4H3/b7-5+,11-6+/t12-,13-,15+/m1/s1 |
| InChIKey | NLKDRIXWXCDONI-USGXOTKMSA-N |
| XLogP | 3.22 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|