C19H24N2O — CID 162878109
(4S,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-triene (PubChem CID 162878109) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (4S,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-triene.
| Compound Name | (4S,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-triene |
|---|---|
| PubChem CID | 162878109 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (4S,12S,13R,16R,17S,18R,20S)-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-triene |
| SMILES | C[C@H]1OC[C@@H]2[C@H]3C[C@@H]4N(CC[C@@]45c4ccccc4N[C@@H]25)C[C@H]31 |
| InChI | InChI=1S/C19H24N2O/c1-11-13-9-21-7-6-19-15-4-2-3-5-16(15)20-18(19)14(10-22-11)12(13)8-17(19)21/h2-5,11-14,17-18,20H,6-10H2,1H3/t11-,12+,13+,14-,17+,18+,19-/m1/s1 |
| InChIKey | QPOYXHLTUXFCCU-RLLFADLLSA-N |
| XLogP | 2.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |