C18H22O5 — CID 162878597
methyl 2-[(2R,3R,4aR,8aR)-3-acetyloxy-4a-methyl-8-methylidene-7-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate (PubChem CID 162878597) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4aR,8aR)-3-acetyloxy-4a-methyl-8-methylidene-7-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2R,3R,4aR,8aR)-3-acetyloxy-4a-methyl-8-methylidene-7-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162878597 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | methyl 2-[(2R,3R,4aR,8aR)-3-acetyloxy-4a-methyl-8-methylidene-7-oxo-2,3,4,8a-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H]1C[C@H]2C(=C)C(=O)C=C[C@@]2(C)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O5/c1-10(17(21)22-5)13-8-14-11(2)15(20)6-7-18(14,4)9-16(13)23-12(3)19/h6-7,13-14,16H,1-2,8-9H2,3-5H3/t13-,14+,16-,18+/m1/s1 |
| InChIKey | GJAARPKBDFKHFS-KKBFJZEXSA-N |
| XLogP | 2.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|