C27H30O7 — CID 162878680
(1S,4S,12S,14S,15S,18S,23S,24S,25R)-14-hydroxy-3,7,8,19,24-pentamethyl-5,9,13,26-tetraoxaheptacyclo[21.2.1.04,12.04,15.06,11.015,25.018,24]hexacosa-2,6(11),7,19-tetraene-10,21-dione (PubChem CID 162878680) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is (1S,4S,12S,14S,15S,18S,23S,24S,25R)-14-hydroxy-3,7,8,19,24-pentamethyl-5,9,13,26-tetraoxaheptacyclo[21.2.1.04,12.04,15.06,11.015,25.018,24]hexacosa-2,6(11),7,19-tetraene-10,21-dione.
| Compound Name | (1S,4S,12S,14S,15S,18S,23S,24S,25R)-14-hydroxy-3,7,8,19,24-pentamethyl-5,9,13,26-tetraoxaheptacyclo[21.2.1.04,12.04,15.06,11.015,25.018,24]hexacosa-2,6(11),7,19-tetraene-10,21-dione |
|---|---|
| PubChem CID | 162878680 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (1S,4S,12S,14S,15S,18S,23S,24S,25R)-14-hydroxy-3,7,8,19,24-pentamethyl-5,9,13,26-tetraoxaheptacyclo[21.2.1.04,12.04,15.06,11.015,25.018,24]hexacosa-2,6(11),7,19-tetraene-10,21-dione |
| SMILES | CC1=CC(=O)C[C@@H]2O[C@H]3C=C(C)[C@@]45Oc6c(C)c(C)oc(=O)c6[C@@H]4O[C@H](O)[C@]54CC[C@@H]1[C@@]2(C)[C@@H]34 |
| InChI | InChI=1S/C27H30O7/c1-11-8-15(28)10-18-25(5)16(11)6-7-26-21(25)17(32-18)9-12(2)27(26)22(33-24(26)30)19-20(34-27)13(3)14(4)31-23(19)29/h8-9,16-18,21-22,24,30H,6-7,10H2,1-5H3/t16-,17-,18-,21+,22-,24-,25+,26+,27+/m0/s1 |
| InChIKey | JPXZJDMFVHWBKF-PECDJVAZSA-N |
| XLogP | 3.44 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|