C20H38O7 — CID 162878827
(4S,5S,6R)-2,6-dimethyl-5-[(3R,4R,5R)-3,5,7-trihydroxy-3,7-dimethyloct-1-en-4-yl]oxyoct-7-ene-2,4,6-triol (PubChem CID 162878827) has the molecular formula C20H38O7 and a molecular weight of 390.52 g/mol. Its IUPAC name is (4S,5S,6R)-2,6-dimethyl-5-[(3R,4R,5R)-3,5,7-trihydroxy-3,7-dimethyloct-1-en-4-yl]oxyoct-7-ene-2,4,6-triol.
| Compound Name | (4S,5S,6R)-2,6-dimethyl-5-[(3R,4R,5R)-3,5,7-trihydroxy-3,7-dimethyloct-1-en-4-yl]oxyoct-7-ene-2,4,6-triol |
|---|---|
| PubChem CID | 162878827 |
| Molecular Formula | C20H38O7 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (4S,5S,6R)-2,6-dimethyl-5-[(3R,4R,5R)-3,5,7-trihydroxy-3,7-dimethyloct-1-en-4-yl]oxyoct-7-ene-2,4,6-triol |
| SMILES | C=C[C@@](C)(O)[C@H](O[C@@H]([C@@H](O)CC(C)(C)O)[C@](C)(O)C=C)[C@H](O)CC(C)(C)O |
| InChI | InChI=1S/C20H38O7/c1-9-19(7,25)15(13(21)11-17(3,4)23)27-16(20(8,26)10-2)14(22)12-18(5,6)24/h9-10,13-16,21-26H,1-2,11-12H2,3-8H3/t13-,14+,15-,16+,19-,20-/m1/s1 |
| InChIKey | RZOLATFOMQUCOR-SPBSJPQISA-N |
| XLogP | 0.66 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|