C63H72N4O10 — CID 162879068
CID 162879068 (PubChem CID 162879068) has the molecular formula C63H72N4O10 and a molecular weight of 1045.29 g/mol.
| Compound Name | CID 162879068 |
|---|---|
| PubChem CID | 162879068 |
| Molecular Formula | C63H72N4O10 |
| Molecular Weight | 1045.29 g/mol |
| Exact Mass | 1044.52 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CCC5(C4)NC(C(C)O)CCC5n4ccc5[nH]ccc54)C4CC(O)CCC4C3C2CC(=O)CC(CCc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C63H72N4O10/c1-36(69)50-16-18-58(67-24-20-52-53(67)19-23-64-52)63(66-50)22-21-62(35-63)34-38-28-48-45-32-55(73)56(75-2)33-46(45)47(60(38)44-15-13-39(70)31-49(44)62)30-40(71)29-41(14-11-37-12-17-54(72)57(27-37)76-26-25-68)77-59(74)10-6-4-8-43-42-7-3-5-9-51(42)65-61(43)48/h3,5,7,9,12,17,19-20,23-24,27-28,32-33,36,38-39,41,44,47,49-50,58,60,64-66,68-70,72-73H,8,10-11,13-16,18,21-22,25-26,29-31,34-35H2,1-2H3 |
| InChIKey | JNOVDZGSGLGVQO-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 211.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.29 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|