C20H26O3 — CID 162879101
[(1R,8S,8aR)-8,8a-dimethyl-4-oxo-2-prop-1-en-2-yl-1,6,7,8-tetrahydronaphthalen-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162879101) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(1R,8S,8aR)-8,8a-dimethyl-4-oxo-2-prop-1-en-2-yl-1,6,7,8-tetrahydronaphthalen-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,8S,8aR)-8,8a-dimethyl-4-oxo-2-prop-1-en-2-yl-1,6,7,8-tetrahydronaphthalen-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162879101 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(1R,8S,8aR)-8,8a-dimethyl-4-oxo-2-prop-1-en-2-yl-1,6,7,8-tetrahydronaphthalen-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)C1=CC(=O)C2=CCC[C@H](C)[C@@]2(C)[C@@H]1OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C20H26O3/c1-7-13(4)19(22)23-18-15(12(2)3)11-17(21)16-10-8-9-14(5)20(16,18)6/h7,10-11,14,18H,2,8-9H2,1,3-6H3/b13-7-/t14-,18+,20+/m0/s1 |
| InChIKey | LHZDXRMTFYWFRM-KSEJUSODSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|