C21H32O3 — CID 162879111
methyl (1R,4aS,4bR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 162879111) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is methyl (1R,4aS,4bR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,4bR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 162879111 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl (1R,4aS,4bR,7S,8aS,10aS)-7-ethenyl-1,4a,7-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | C=C[C@@]1(C)CC[C@@H]2[C@H](C1)C(=O)C[C@H]1[C@@]2(C)CCC[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C21H32O3/c1-6-19(2)11-8-15-14(13-19)16(22)12-17-20(15,3)9-7-10-21(17,4)18(23)24-5/h6,14-15,17H,1,7-13H2,2-5H3/t14-,15+,17-,19-,20-,21+/m0/s1 |
| InChIKey | BYEVUJCRIPNIBY-DSKDBUPWSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|