C30H48O2 — CID 162879177
3-[(1S,2S,4aR,6aR,10aR,10bS,12aS)-1,4a,6a,9,9,10b-hexamethyl-2-prop-1-en-2-yl-3,4,6,7,8,10,10a,11,12,12a-decahydro-2H-chrysen-1-yl]propanoic acid (PubChem CID 162879177) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is 3-[(1S,2S,4aR,6aR,10aR,10bS,12aS)-1,4a,6a,9,9,10b-hexamethyl-2-prop-1-en-2-yl-3,4,6,7,8,10,10a,11,12,12a-decahydro-2H-chrysen-1-yl]propanoic acid.
| Compound Name | 3-[(1S,2S,4aR,6aR,10aR,10bS,12aS)-1,4a,6a,9,9,10b-hexamethyl-2-prop-1-en-2-yl-3,4,6,7,8,10,10a,11,12,12a-decahydro-2H-chrysen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 162879177 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | 3-[(1S,2S,4aR,6aR,10aR,10bS,12aS)-1,4a,6a,9,9,10b-hexamethyl-2-prop-1-en-2-yl-3,4,6,7,8,10,10a,11,12,12a-decahydro-2H-chrysen-1-yl]propanoic acid |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)C3=CC[C@@]4(C)CCC(C)(C)C[C@H]4[C@]3(C)CC[C@H]2[C@@]1(C)CCC(=O)O |
| InChI | InChI=1S/C30H48O2/c1-20(2)21-9-14-29(7)22(28(21,6)16-12-25(31)32)11-15-30(8)23(29)10-13-27(5)18-17-26(3,4)19-24(27)30/h10,21-22,24H,1,9,11-19H2,2-8H3,(H,31,32)/t21-,22-,24+,27-,28-,29+,30+/m0/s1 |
| InChIKey | ZKZFSXNXILKKRB-HJPLSKARSA-N |
| XLogP | 8.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|