C10H14O4 — CID 162879923
(2S,4R,5E)-4-hydroxy-2-methyl-2,3,4,7-tetrahydrooxecine-8,10-dione (PubChem CID 162879923) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2S,4R,5E)-4-hydroxy-2-methyl-2,3,4,7-tetrahydrooxecine-8,10-dione.
| Compound Name | (2S,4R,5E)-4-hydroxy-2-methyl-2,3,4,7-tetrahydrooxecine-8,10-dione |
|---|---|
| PubChem CID | 162879923 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2S,4R,5E)-4-hydroxy-2-methyl-2,3,4,7-tetrahydrooxecine-8,10-dione |
| SMILES | C[C@H]1C[C@@H](O)/C=C/CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C10H14O4/c1-7-5-8(11)3-2-4-9(12)6-10(13)14-7/h2-3,7-8,11H,4-6H2,1H3/b3-2+/t7-,8-/m0/s1 |
| InChIKey | MVKKKYNXENCTKJ-HZIBQTDNSA-N |
| XLogP | 0.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|