C15H26O2 — CID 162879936
(2Z,6E,10S)-2,6,10-trimethyldodeca-2,6,11-triene-1,10-diol (PubChem CID 162879936) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2Z,6E,10S)-2,6,10-trimethyldodeca-2,6,11-triene-1,10-diol.
| Compound Name | (2Z,6E,10S)-2,6,10-trimethyldodeca-2,6,11-triene-1,10-diol |
|---|---|
| PubChem CID | 162879936 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2Z,6E,10S)-2,6,10-trimethyldodeca-2,6,11-triene-1,10-diol |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)CC/C=C(/C)CO |
| InChI | InChI=1S/C15H26O2/c1-5-15(4,17)11-7-10-13(2)8-6-9-14(3)12-16/h5,9-10,16-17H,1,6-8,11-12H2,2-4H3/b13-10+,14-9-/t15-/m1/s1 |
| InChIKey | YXIFOKDKHGSQOB-SVXHRKKWSA-N |
| XLogP | 3.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|