C20H30O2 — CID 162880010
(6E,10R,11E,13Z)-10-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one (PubChem CID 162880010) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (6E,10R,11E,13Z)-10-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one.
| Compound Name | (6E,10R,11E,13Z)-10-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one |
|---|---|
| PubChem CID | 162880010 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (6E,10R,11E,13Z)-10-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,11,13,15-pentaen-4-one |
| SMILES | C=C/C(C)=C\C=C\[C@](C)(O)CC/C=C(\C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C20H30O2/c1-7-17(4)10-8-12-20(6,22)13-9-11-18(5)15-19(21)14-16(2)3/h7-8,10-12,14,22H,1,9,13,15H2,2-6H3/b12-8+,17-10-,18-11+/t20-/m0/s1 |
| InChIKey | WUHOVSGGPXLETP-SIDWXSIXSA-N |
| XLogP | 5.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|