About 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol
3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol (PubChem CID 162881127) has the molecular formula C10H16N2O3S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol |
| PubChem CID | 162881127 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol |
| SMILES | OCC1CC(NCc2nccs2)C(O)C1O |
| InChI | InChI=1S/C10H16N2O3S/c13-5-6-3-7(10(15)9(6)14)12-4-8-11-1-2-16-8/h1-2,6-7,9-10,12-15H,3-5H2 |
| InChIKey | ADOMAJDXOBXOMD-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol?
The IUPAC name of 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol (CID 162881127) is 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol.
What is the SMILES notation for 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol?
The canonical SMILES for 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol is OCC1CC(NCc2nccs2)C(O)C1O.
What is the InChIKey of 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol?
The InChIKey is ADOMAJDXOBXOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S/c13-5-6-3-7(10(15)9(6)14)12-4-8-11-1-2-16-8/h1-2,6-7,9-10,12-15H,3-5H2.
What are the key properties of 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol?
3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol has a molecular weight of 244.32 g/mol, XLogP of -0.66, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-5-(1,3-thiazol-2-ylmethylamino)cyclopentane-1,2-diol is sourced from PubChem (CID 162881127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).