C16H26 — CID 162881187
4,8,12,12-tetramethylcyclododeca-1,4,8-triene (PubChem CID 162881187) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 4,8,12,12-tetramethylcyclododeca-1,4,8-triene.
| Compound Name | 4,8,12,12-tetramethylcyclododeca-1,4,8-triene |
|---|---|
| PubChem CID | 162881187 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 4,8,12,12-tetramethylcyclododeca-1,4,8-triene |
| SMILES | CC1=CCCC(C)=CCCC(C)(C)C=CC1 |
| InChI | InChI=1S/C16H26/c1-14-8-5-9-15(2)11-7-13-16(3,4)12-6-10-14/h6,8,11-12H,5,7,9-10,13H2,1-4H3 |
| InChIKey | QNQINECMNZQLPK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|