C29H44O2 — CID 162881206
17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-dione (PubChem CID 162881206) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-dione.
| Compound Name | 17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-dione |
|---|---|
| PubChem CID | 162881206 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 17-(5-ethyl-6-methylhept-3-en-2-yl)-10,13-dimethyl-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-dione |
| SMILES | CCC(C=CC(C)C1CCC2C3C(=O)C=C4CC(=O)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C29H44O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h8-9,17-20,23-25,27H,7,10-16H2,1-6H3 |
| InChIKey | KPJHPDBIDIPMHT-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|