C26H44O8 — CID 162881258
2-[2-hydroxy-1-(7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162881258) has the molecular formula C26H44O8 and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[2-hydroxy-1-(7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[2-hydroxy-1-(7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162881258 |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2-[2-hydroxy-1-(7-hydroxy-2,4b,8,8-tetramethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1(C(CO)OC2OC(CO)C(O)C(O)C2O)C=C2CCC3C(C)(C)C(O)CCC3(C)C2CC1 |
| InChI | InChI=1S/C26H44O8/c1-24(2)17-6-5-14-11-25(3,9-7-15(14)26(17,4)10-8-18(24)29)19(13-28)34-23-22(32)21(31)20(30)16(12-27)33-23/h11,15-23,27-32H,5-10,12-13H2,1-4H3 |
| InChIKey | VHQUXCVQRTXIDB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|