C15H22O2 — CID 162881297
3-hydroxy-4a-methyl-7-propan-2-yl-3,4,5,6-tetrahydro-2H-naphthalene-1-carbaldehyde (PubChem CID 162881297) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-hydroxy-4a-methyl-7-propan-2-yl-3,4,5,6-tetrahydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | 3-hydroxy-4a-methyl-7-propan-2-yl-3,4,5,6-tetrahydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 162881297 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-hydroxy-4a-methyl-7-propan-2-yl-3,4,5,6-tetrahydro-2H-naphthalene-1-carbaldehyde |
| SMILES | CC(C)C1=CC2=C(C=O)CC(O)CC2(C)CC1 |
| InChI | InChI=1S/C15H22O2/c1-10(2)11-4-5-15(3)8-13(17)6-12(9-16)14(15)7-11/h7,9-10,13,17H,4-6,8H2,1-3H3 |
| InChIKey | HKIJSJGUDJGJKU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|