C26H41NO2 — CID 162881357
(2R)-2-[(1S,1aR,4aS,6R,7aR,7bS)-6-cyclopentyl-1-[(1S,3S)-3-(hydroxymethyl)cyclohexyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]-2-aminoacetaldehyde (PubChem CID 162881357) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (2R)-2-[(1S,1aR,4aS,6R,7aR,7bS)-6-cyclopentyl-1-[(1S,3S)-3-(hydroxymethyl)cyclohexyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]-2-aminoacetaldehyde.
| Compound Name | (2R)-2-[(1S,1aR,4aS,6R,7aR,7bS)-6-cyclopentyl-1-[(1S,3S)-3-(hydroxymethyl)cyclohexyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]-2-aminoacetaldehyde |
|---|---|
| PubChem CID | 162881357 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (2R)-2-[(1S,1aR,4aS,6R,7aR,7bS)-6-cyclopentyl-1-[(1S,3S)-3-(hydroxymethyl)cyclohexyl]-4-methylidene-2,3,4a,5,6,7,7a,7b-octahydro-1aH-cyclopropa[e]azulen-1-yl]-2-aminoacetaldehyde |
| SMILES | C=C1CC[C@@H]2[C@H]([C@@H]3C[C@@H](C4CCCC4)C[C@H]13)[C@@]2([C@H]1CCC[C@H](CO)C1)[C@@H](N)C=O |
| InChI | InChI=1S/C26H41NO2/c1-16-9-10-23-25(22-13-19(12-21(16)22)18-6-2-3-7-18)26(23,24(27)15-29)20-8-4-5-17(11-20)14-28/h15,17-25,28H,1-14,27H2/t17-,19-,20-,21+,22+,23+,24-,25-,26+/m0/s1 |
| InChIKey | AMDIRHCSHNWNKP-AKOJHMQVSA-N |
| XLogP | 4.73 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|