C30H50O — CID 162882006
(2S,4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3,4,5,8,8a-hexahydronaphthalen-2-ol (PubChem CID 162882006) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (2S,4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3,4,5,8,8a-hexahydronaphthalen-2-ol.
| Compound Name | (2S,4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3,4,5,8,8a-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 162882006 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (2S,4aS,5S,8aR)-1,1,4a,6-tetramethyl-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2,3,4,5,8,8a-hexahydronaphthalen-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@H]1C(C)=CC[C@H]2C(C)(C)[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C30H50O/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-26-25(5)18-19-27-29(6,7)28(31)20-21-30(26,27)8/h12,14,16,18,26-28,31H,9-11,13,15,17,19-21H2,1-8H3/b23-14+,24-16+/t26-,27-,28-,30-/m0/s1 |
| InChIKey | BPGVNJWOXOAFIV-VIDNDQRISA-N |
| XLogP | 8.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|