C19H30O — CID 162882406
(1S,2S,3R,4S,6S,7S,8R,9S,12R)-4-(6-methoxyhexyl)pentacyclo[6.4.0.02,7.03,6.09,12]dodecane (PubChem CID 162882406) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1S,2S,3R,4S,6S,7S,8R,9S,12R)-4-(6-methoxyhexyl)pentacyclo[6.4.0.02,7.03,6.09,12]dodecane.
| Compound Name | (1S,2S,3R,4S,6S,7S,8R,9S,12R)-4-(6-methoxyhexyl)pentacyclo[6.4.0.02,7.03,6.09,12]dodecane |
|---|---|
| PubChem CID | 162882406 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1S,2S,3R,4S,6S,7S,8R,9S,12R)-4-(6-methoxyhexyl)pentacyclo[6.4.0.02,7.03,6.09,12]dodecane |
| SMILES | COCCCCCC[C@H]1C[C@@H]2[C@H]3[C@@H]4[C@H]5CC[C@H]5[C@@H]4[C@H]3[C@H]12 |
| InChI | InChI=1S/C19H30O/c1-20-9-5-3-2-4-6-11-10-14-15(11)19-17-13-8-7-12(13)16(17)18(14)19/h11-19H,2-10H2,1H3/t11-,12-,13+,14-,15+,16+,17-,18-,19+/m0/s1 |
| InChIKey | CTAAJYJEMMTTGX-WVKHSLOLSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|