C24H42 — CID 162882710
(2E,6E,9R)-6,14-dimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6-diene (PubChem CID 162882710) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is (2E,6E,9R)-6,14-dimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6-diene.
| Compound Name | (2E,6E,9R)-6,14-dimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6-diene |
|---|---|
| PubChem CID | 162882710 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | (2E,6E,9R)-6,14-dimethyl-10-methylidene-9-[(3R)-3-methylpent-4-enyl]pentadeca-2,6-diene |
| SMILES | C=C[C@H](C)CC[C@H](C/C=C(\C)CC/C=C/C)C(=C)CCCC(C)C |
| InChI | InChI=1S/C24H42/c1-8-10-11-14-22(6)17-19-24(18-16-21(5)9-2)23(7)15-12-13-20(3)4/h8-10,17,20-21,24H,2,7,11-16,18-19H2,1,3-6H3/b10-8+,22-17+/t21-,24+/m0/s1 |
| InChIKey | PQSQPHWBYNFUOI-CKXXDYJYSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|