C28H33NO9 — CID 162883137
(7R,9R,10R)-7-[(2R,4S,5R,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,9,10,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 162883137) has the molecular formula C28H33NO9 and a molecular weight of 527.57 g/mol. Its IUPAC name is (7R,9R,10R)-7-[(2R,4S,5R,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,9,10,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7R,9R,10R)-7-[(2R,4S,5R,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,9,10,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 162883137 |
| Molecular Formula | C28H33NO9 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (7R,9R,10R)-7-[(2R,4S,5R,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-1,9,10,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC[C@@]1(O)C[C@@H](O[C@H]2C[C@H](N(C)C)[C@@H](O)[C@@H](C)O2)c2cc3c(c(O)c2[C@H]1O)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C28H33NO9/c1-5-28(36)11-18(38-19-10-16(29(3)4)23(31)12(2)37-19)14-9-15-21(26(34)22(14)27(28)35)25(33)20-13(24(15)32)7-6-8-17(20)30/h6-9,12,16,18-19,23,27,30-31,34-36H,5,10-11H2,1-4H3/t12-,16+,18-,19+,23+,27-,28-/m1/s1 |
| InChIKey | KINWCWBLNJXBPJ-HVHCXOLOSA-N |
| XLogP | 1.94 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|