C15H24O3 — CID 162883141
(2E,6E,8R,10E)-8,12-dihydroxy-2,6,10-trimethyldodeca-2,6,10-trienal (PubChem CID 162883141) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (2E,6E,8R,10E)-8,12-dihydroxy-2,6,10-trimethyldodeca-2,6,10-trienal.
| Compound Name | (2E,6E,8R,10E)-8,12-dihydroxy-2,6,10-trimethyldodeca-2,6,10-trienal |
|---|---|
| PubChem CID | 162883141 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (2E,6E,8R,10E)-8,12-dihydroxy-2,6,10-trimethyldodeca-2,6,10-trienal |
| SMILES | C/C(C=O)=C\CC/C(C)=C/[C@H](O)C/C(C)=C/CO |
| InChI | InChI=1S/C15H24O3/c1-12(5-4-6-14(3)11-17)9-15(18)10-13(2)7-8-16/h6-7,9,11,15-16,18H,4-5,8,10H2,1-3H3/b12-9+,13-7+,14-6+/t15-/m0/s1 |
| InChIKey | CBWQPNCUTFARPC-QUIIXDALSA-N |
| XLogP | 2.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|