C22H30O6 — CID 162883279
[(3R,5R,5aS,6S)-5-acetyloxy-3,5a,9-trimethyl-2-oxo-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162883279) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(3R,5R,5aS,6S)-5-acetyloxy-3,5a,9-trimethyl-2-oxo-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3R,5R,5aS,6S)-5-acetyloxy-3,5a,9-trimethyl-2-oxo-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162883279 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(3R,5R,5aS,6S)-5-acetyloxy-3,5a,9-trimethyl-2-oxo-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CC=C(C)C2C3OC(=O)[C@H](C)C3C[C@@H](OC(C)=O)[C@]21C |
| InChI | InChI=1S/C22H30O6/c1-7-11(2)20(24)27-16-9-8-12(3)18-19-15(13(4)21(25)28-19)10-17(22(16,18)6)26-14(5)23/h7-8,13,15-19H,9-10H2,1-6H3/b11-7-/t13-,15?,16+,17-,18?,19?,22-/m1/s1 |
| InChIKey | AIRAUUXPYGGOPL-ZKEXCHKWSA-N |
| XLogP | 3.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|