C20H24O5 — CID 162883491
7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]-8-methoxychromen-2-one (PubChem CID 162883491) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]-8-methoxychromen-2-one.
| Compound Name | 7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 162883491 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]-8-methoxychromen-2-one |
| SMILES | COc1c(OC/C=C(\C)C[C@@H](O)C=C(C)C)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C20H24O5/c1-13(2)11-16(21)12-14(3)9-10-24-17-7-5-15-6-8-18(22)25-19(15)20(17)23-4/h5-9,11,16,21H,10,12H2,1-4H3/b14-9+/t16-/m0/s1 |
| InChIKey | GFBKICMDIVRKJO-IDJPSDCMSA-N |
| XLogP | 3.84 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|