C20H32O2 — CID 162883653
(1R,2R,3S,6S,9R,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yltetracyclo[7.5.0.02,6.011,13]tetradecan-7-one (PubChem CID 162883653) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,2R,3S,6S,9R,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yltetracyclo[7.5.0.02,6.011,13]tetradecan-7-one.
| Compound Name | (1R,2R,3S,6S,9R,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yltetracyclo[7.5.0.02,6.011,13]tetradecan-7-one |
|---|---|
| PubChem CID | 162883653 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,2R,3S,6S,9R,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yltetracyclo[7.5.0.02,6.011,13]tetradecan-7-one |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)C(=O)C[C@@]3(C)C[C@H]4C[C@@]4(C)[C@@H](O)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-11(2)13-6-7-19(4)14(21)10-18(3)8-12-9-20(12,5)17(22)16(18)15(13)19/h11-13,15-17,22H,6-10H2,1-5H3/t12-,13-,15+,16-,17-,18+,19+,20+/m0/s1 |
| InChIKey | ILFMQXQRJLIDJX-SCUWQPKTSA-N |
| XLogP | 4.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |