C25H38O5 — CID 162883739
[(2S)-2-[(1S,2S,3E,7E,10S)-2-hydroxy-4,8-dimethyl-10-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl]propyl] (Z)-2-methylbut-2-enoate (PubChem CID 162883739) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is [(2S)-2-[(1S,2S,3E,7E,10S)-2-hydroxy-4,8-dimethyl-10-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl]propyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2S)-2-[(1S,2S,3E,7E,10S)-2-hydroxy-4,8-dimethyl-10-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl]propyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162883739 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(2S)-2-[(1S,2S,3E,7E,10S)-2-hydroxy-4,8-dimethyl-10-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl]propyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC[C@@H](C)[C@@H]1[C@@H](OC(=O)/C(C)=C\C)C/C(C)=C/CC/C(C)=C/[C@@H]1O |
| InChI | InChI=1S/C25H38O5/c1-8-18(5)24(27)29-15-20(7)23-21(26)13-16(3)11-10-12-17(4)14-22(23)30-25(28)19(6)9-2/h8-9,12-13,20-23,26H,10-11,14-15H2,1-7H3/b16-13+,17-12+,18-8-,19-9-/t20-,21+,22+,23+/m1/s1 |
| InChIKey | YUEOTHPHUBXRFE-HDACCSAGSA-N |
| XLogP | 5.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|