C15H23Br2ClO — CID 162883864
(2R,4R,6R,9S,10R)-4,10-dibromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undecan-2-ol (PubChem CID 162883864) has the molecular formula C15H23Br2ClO and a molecular weight of 414.61 g/mol. Its IUPAC name is (2R,4R,6R,9S,10R)-4,10-dibromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undecan-2-ol.
| Compound Name | (2R,4R,6R,9S,10R)-4,10-dibromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undecan-2-ol |
|---|---|
| PubChem CID | 162883864 |
| Molecular Formula | C15H23Br2ClO |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | (2R,4R,6R,9S,10R)-4,10-dibromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undecan-2-ol |
| SMILES | C=C1[C@H](O)C[C@@H](Br)C(C)(C)[C@@]12CC[C@](C)(Cl)[C@H](Br)C2 |
| InChI | InChI=1S/C15H23Br2ClO/c1-9-10(19)7-11(16)13(2,3)15(9)6-5-14(4,18)12(17)8-15/h10-12,19H,1,5-8H2,2-4H3/t10-,11-,12-,14+,15-/m1/s1 |
| InChIKey | ZLPHPQMHLUYFBP-MYYUVRNCSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|