C14H18O8 — CID 162885041
[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] acetate (PubChem CID 162885041) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is [4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] acetate.
| Compound Name | [4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] acetate |
|---|---|
| PubChem CID | 162885041 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C14H18O8/c1-7(16)20-8-2-4-9(5-3-8)21-14-13(19)12(18)11(17)10(6-15)22-14/h2-5,10-15,17-19H,6H2,1H3 |
| InChIKey | PYJJZTWPOICPPH-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|