C14H22O8 — CID 162885451
[(2R,3R)-3-hydroxy-2-(hydroxymethyl)-4-methoxy-4-oxobutyl] (2E,4S,5S,6E)-4,5-dihydroxyocta-2,6-dienoate (PubChem CID 162885451) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is [(2R,3R)-3-hydroxy-2-(hydroxymethyl)-4-methoxy-4-oxobutyl] (2E,4S,5S,6E)-4,5-dihydroxyocta-2,6-dienoate.
| Compound Name | [(2R,3R)-3-hydroxy-2-(hydroxymethyl)-4-methoxy-4-oxobutyl] (2E,4S,5S,6E)-4,5-dihydroxyocta-2,6-dienoate |
|---|---|
| PubChem CID | 162885451 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(2R,3R)-3-hydroxy-2-(hydroxymethyl)-4-methoxy-4-oxobutyl] (2E,4S,5S,6E)-4,5-dihydroxyocta-2,6-dienoate |
| SMILES | C/C=C/[C@H](O)[C@@H](O)/C=C/C(=O)OC[C@@H](CO)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C14H22O8/c1-3-4-10(16)11(17)5-6-12(18)22-8-9(7-15)13(19)14(20)21-2/h3-6,9-11,13,15-17,19H,7-8H2,1-2H3/b4-3+,6-5+/t9-,10+,11+,13-/m1/s1 |
| InChIKey | OOPWNLISSIKRHD-WFRNYVPISA-N |
| XLogP | -1.47 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|