C44H72 — CID 162885460
2,6,10,14,18,22,26,30,34-nonamethylpentatriaconta-1,5,9,13,17,21,25,29,33-nonaene (PubChem CID 162885460) has the molecular formula C44H72 and a molecular weight of 601.06 g/mol. Its IUPAC name is 2,6,10,14,18,22,26,30,34-nonamethylpentatriaconta-1,5,9,13,17,21,25,29,33-nonaene.
| Compound Name | 2,6,10,14,18,22,26,30,34-nonamethylpentatriaconta-1,5,9,13,17,21,25,29,33-nonaene |
|---|---|
| PubChem CID | 162885460 |
| Molecular Formula | C44H72 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.56 |
| IUPAC Name | 2,6,10,14,18,22,26,30,34-nonamethylpentatriaconta-1,5,9,13,17,21,25,29,33-nonaene |
| SMILES | C=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C44H72/c1-36(2)20-12-22-38(5)24-14-26-40(7)28-16-30-42(9)32-18-34-44(11)35-19-33-43(10)31-17-29-41(8)27-15-25-39(6)23-13-21-37(3)4/h21-22,25-26,29-30,33-34H,1,12-20,23-24,27-28,31-32,35H2,2-11H3 |
| InChIKey | XWMBVZQDSHLHIR-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|