C35H56O13 — CID 162885548
2-[(5-hydroxy-3,4-dimethoxy-6-methyloxan-2-yl)oxymethyl]-9-(3-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-3,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadeca-6,14-diene-5,13-dione (PubChem CID 162885548) has the molecular formula C35H56O13 and a molecular weight of 684.82 g/mol. Its IUPAC name is 2-[(5-hydroxy-3,4-dimethoxy-6-methyloxan-2-yl)oxymethyl]-9-(3-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-3,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadeca-6,14-diene-5,13-dione.
| Compound Name | 2-[(5-hydroxy-3,4-dimethoxy-6-methyloxan-2-yl)oxymethyl]-9-(3-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-3,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadeca-6,14-diene-5,13-dione |
|---|---|
| PubChem CID | 162885548 |
| Molecular Formula | C35H56O13 |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | 2-[(5-hydroxy-3,4-dimethoxy-6-methyloxan-2-yl)oxymethyl]-9-(3-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-3,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadeca-6,14-diene-5,13-dione |
| SMILES | COC1CC(C)OC(OC2C(C)C=CC(=O)OC(C)C(COC3OC(C)C(O)C(OC)C3OC)C3OC3C=CC(=O)C(C)CC2C)C1O |
| InChI | InChI=1S/C35H56O13/c1-17-10-13-27(37)45-21(5)23(16-43-35-33(42-9)32(41-8)28(38)22(6)46-35)31-25(47-31)12-11-24(36)18(2)14-19(3)30(17)48-34-29(39)26(40-7)15-20(4)44-34/h10-13,17-23,25-26,28-35,38-39H,14-16H2,1-9H3 |
| InChIKey | ROOVPJUGPLYZDD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|