C26H36O6 — CID 162885781
[10-[4-acetyloxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] 2-methylprop-2-enoate (PubChem CID 162885781) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is [10-[4-acetyloxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] 2-methylprop-2-enoate.
| Compound Name | [10-[4-acetyloxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162885781 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [10-[4-acetyloxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC=C(C)CCC=C(C)CCC=C1C(=O)OC(C=C(C)C)C1OC(C)=O |
| InChI | InChI=1S/C26H36O6/c1-17(2)16-23-24(31-21(7)27)22(26(29)32-23)13-9-12-19(5)10-8-11-20(6)14-15-30-25(28)18(3)4/h10,13-14,16,23-24H,3,8-9,11-12,15H2,1-2,4-7H3 |
| InChIKey | VSUAUQMIDRMCCY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|