C16H20O4 — CID 162885818
(2S)-5,7-dihydroxy-2,8-dimethyl-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 162885818) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2S)-5,7-dihydroxy-2,8-dimethyl-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-5,7-dihydroxy-2,8-dimethyl-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162885818 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2S)-5,7-dihydroxy-2,8-dimethyl-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1c(O)c(C)c2c(c1O)C(=O)C[C@H](C)O2 |
| InChI | InChI=1S/C16H20O4/c1-8(2)5-6-11-14(18)10(4)16-13(15(11)19)12(17)7-9(3)20-16/h5,9,18-19H,6-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | ZSHQWJSVJJBSBS-VIFPVBQESA-N |
| XLogP | 3.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|