C22H32O4 — CID 162886309
[(1S,2E,6S,8S,11E,13S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-13-yl] acetate (PubChem CID 162886309) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1S,2E,6S,8S,11E,13S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-13-yl] acetate.
| Compound Name | [(1S,2E,6S,8S,11E,13S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-13-yl] acetate |
|---|---|
| PubChem CID | 162886309 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1S,2E,6S,8S,11E,13S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-13-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC2=C(C)CO[C@H]2/C=C(\C)CC[C@@H]2O[C@@]2(C)CC/C=C/1C |
| InChI | InChI=1S/C22H32O4/c1-14-8-9-21-22(5,26-21)10-6-7-15(2)19(25-17(4)23)12-18-16(3)13-24-20(18)11-14/h7,11,19-21H,6,8-10,12-13H2,1-5H3/b14-11+,15-7+/t19-,20-,21-,22-/m0/s1 |
| InChIKey | PAYHCLHMUGUMRE-VPAJQBHHSA-N |
| XLogP | 4.65 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|