C30H40O4 — CID 162886316
(1R,5R,9R,11E,14S,16S,18R)-18-benzyl-5,14-dihydroxy-9,16-dimethyl-15-methylidenetricyclo[11.7.0.01,17]icos-11-ene-2,20-dione (PubChem CID 162886316) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (1R,5R,9R,11E,14S,16S,18R)-18-benzyl-5,14-dihydroxy-9,16-dimethyl-15-methylidenetricyclo[11.7.0.01,17]icos-11-ene-2,20-dione.
| Compound Name | (1R,5R,9R,11E,14S,16S,18R)-18-benzyl-5,14-dihydroxy-9,16-dimethyl-15-methylidenetricyclo[11.7.0.01,17]icos-11-ene-2,20-dione |
|---|---|
| PubChem CID | 162886316 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (1R,5R,9R,11E,14S,16S,18R)-18-benzyl-5,14-dihydroxy-9,16-dimethyl-15-methylidenetricyclo[11.7.0.01,17]icos-11-ene-2,20-dione |
| SMILES | C=C1C(C)C2[C@H](Cc3ccccc3)CC(=O)[C@]23C(=O)CC[C@H](O)CCC[C@@H](C)C/C=C/C3[C@@H]1O |
| InChI | InChI=1S/C30H40O4/c1-19-9-7-13-24(31)15-16-26(32)30-25(14-8-10-19)29(34)21(3)20(2)28(30)23(18-27(30)33)17-22-11-5-4-6-12-22/h4-6,8,11-12,14,19-20,23-25,28-29,31,34H,3,7,9-10,13,15-18H2,1-2H3/b14-8+/t19-,20?,23-,24-,25?,28?,29-,30+/m1/s1 |
| InChIKey | IBRUEOFXLCCWAB-DZNSWCDXSA-N |
| XLogP | 5.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|