C17H14O5 — CID 162886547
(3R)-5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene-3,6-diol (PubChem CID 162886547) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is (3R)-5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene-3,6-diol.
| Compound Name | (3R)-5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene-3,6-diol |
|---|---|
| PubChem CID | 162886547 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (3R)-5,13-dimethoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene-3,6-diol |
| SMILES | COc1cc2c3c(ccc4cc(O)c(OC)c(c43)[C@H](O)O2)c1 |
| InChI | InChI=1S/C17H14O5/c1-20-10-5-8-3-4-9-6-11(18)16(21-2)15-14(9)13(8)12(7-10)22-17(15)19/h3-7,17-19H,1-2H3/t17-/m1/s1 |
| InChIKey | IXYXOSNVZJQGIR-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|