C21H34O3 — CID 162887074
2-(6-methoxy-4-methylhex-4-enylidene)-6,10-dimethylundeca-5,9-dienoic acid (PubChem CID 162887074) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-(6-methoxy-4-methylhex-4-enylidene)-6,10-dimethylundeca-5,9-dienoic acid.
| Compound Name | 2-(6-methoxy-4-methylhex-4-enylidene)-6,10-dimethylundeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 162887074 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2-(6-methoxy-4-methylhex-4-enylidene)-6,10-dimethylundeca-5,9-dienoic acid |
| SMILES | COCC=C(C)CCC=C(CCC=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C21H34O3/c1-17(2)9-6-10-18(3)11-7-13-20(21(22)23)14-8-12-19(4)15-16-24-5/h9,11,14-15H,6-8,10,12-13,16H2,1-5H3,(H,22,23) |
| InChIKey | PSFGNZBYXOCWDG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|