C18H28O5 — CID 162887332
(3S,4E,6R)-3-hydroxy-3-methyl-9-[(2S)-5-oxooxolan-2-yl]-6-propan-2-yldeca-4,9-dienoic acid (PubChem CID 162887332) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3S,4E,6R)-3-hydroxy-3-methyl-9-[(2S)-5-oxooxolan-2-yl]-6-propan-2-yldeca-4,9-dienoic acid.
| Compound Name | (3S,4E,6R)-3-hydroxy-3-methyl-9-[(2S)-5-oxooxolan-2-yl]-6-propan-2-yldeca-4,9-dienoic acid |
|---|---|
| PubChem CID | 162887332 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3S,4E,6R)-3-hydroxy-3-methyl-9-[(2S)-5-oxooxolan-2-yl]-6-propan-2-yldeca-4,9-dienoic acid |
| SMILES | C=C(CC[C@@H](/C=C/[C@@](C)(O)CC(=O)O)C(C)C)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C18H28O5/c1-12(2)14(9-10-18(4,22)11-16(19)20)6-5-13(3)15-7-8-17(21)23-15/h9-10,12,14-15,22H,3,5-8,11H2,1-2,4H3,(H,19,20)/b10-9+/t14-,15-,18+/m0/s1 |
| InChIKey | LXDMRAQTUIZMLS-DWYJDNMASA-N |
| XLogP | 3.08 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|