C16H25NS — CID 162887382
8-isothiocyanato-5,8a-dimethyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulene (PubChem CID 162887382) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 8-isothiocyanato-5,8a-dimethyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulene.
| Compound Name | 8-isothiocyanato-5,8a-dimethyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulene |
|---|---|
| PubChem CID | 162887382 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 8-isothiocyanato-5,8a-dimethyl-3-propan-2-yl-2,3,3a,6,7,8-hexahydro-1H-azulene |
| SMILES | CC1=CC2C(C(C)C)CCC2(C)C(N=C=S)CC1 |
| InChI | InChI=1S/C16H25NS/c1-11(2)13-7-8-16(4)14(13)9-12(3)5-6-15(16)17-10-18/h9,11,13-15H,5-8H2,1-4H3 |
| InChIKey | BNKMTIDTZNEDLS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|