C25H30O5 — CID 162887523
4a-hydroxy-5',7,8'a-trimethylspiro[4,9a-dihydro-3H-pyrano[2,3-b][1]benzofuran-2,3'-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran]-2'-one (PubChem CID 162887523) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4a-hydroxy-5',7,8'a-trimethylspiro[4,9a-dihydro-3H-pyrano[2,3-b][1]benzofuran-2,3'-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran]-2'-one.
| Compound Name | 4a-hydroxy-5',7,8'a-trimethylspiro[4,9a-dihydro-3H-pyrano[2,3-b][1]benzofuran-2,3'-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran]-2'-one |
|---|---|
| PubChem CID | 162887523 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 4a-hydroxy-5',7,8'a-trimethylspiro[4,9a-dihydro-3H-pyrano[2,3-b][1]benzofuran-2,3'-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran]-2'-one |
| SMILES | Cc1ccc2c(c1)OC1OC3(CCC21O)C(=O)OC1CC2(C)CCCC(C)C2=CC13 |
| InChI | InChI=1S/C25H30O5/c1-14-6-7-16-19(11-14)29-22-24(16,27)9-10-25(30-22)18-12-17-15(2)5-4-8-23(17,3)13-20(18)28-21(25)26/h6-7,11-12,15,18,20,22,27H,4-5,8-10,13H2,1-3H3 |
| InChIKey | KXDGWHCMPZXYPU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|