C21H30O8 — CID 162887817
[(3aS,6R,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-methoxybutanoyl]-6-methyl-3-methylidene-2,5-dioxo-4,6,8,8a-tetrahydro-3aH-cyclohepta[b]furan-8-yl] (2R)-2-methylbutanoate (PubChem CID 162887817) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is [(3aS,6R,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-methoxybutanoyl]-6-methyl-3-methylidene-2,5-dioxo-4,6,8,8a-tetrahydro-3aH-cyclohepta[b]furan-8-yl] (2R)-2-methylbutanoate.
| Compound Name | [(3aS,6R,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-methoxybutanoyl]-6-methyl-3-methylidene-2,5-dioxo-4,6,8,8a-tetrahydro-3aH-cyclohepta[b]furan-8-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162887817 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(3aS,6R,7S,8S,8aR)-7-hydroxy-7-[(3S)-3-methoxybutanoyl]-6-methyl-3-methylidene-2,5-dioxo-4,6,8,8a-tetrahydro-3aH-cyclohepta[b]furan-8-yl] (2R)-2-methylbutanoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1CC(=O)[C@H](C)[C@@](O)(C(=O)C[C@H](C)OC)[C@H]2OC(=O)[C@H](C)CC |
| InChI | InChI=1S/C21H30O8/c1-7-10(2)19(24)29-18-17-14(12(4)20(25)28-17)9-15(22)13(5)21(18,26)16(23)8-11(3)27-6/h10-11,13-14,17-18,26H,4,7-9H2,1-3,5-6H3/t10-,11+,13+,14+,17-,18+,21-/m1/s1 |
| InChIKey | BXKGAYOASXGOFL-JOUYPQPFSA-N |
| XLogP | 1.38 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|