C21H40O12 — CID 162888423
methyl (2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-[(2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane-2-carboxylate (PubChem CID 162888423) has the molecular formula C21H40O12 and a molecular weight of 484.54 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-[(2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-[(2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 162888423 |
| Molecular Formula | C21H40O12 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-trimethoxy-6-[(2R,3R,4S,5S)-1,2,4,5,6-pentamethoxyhexan-3-yl]oxyoxane-2-carboxylate |
| SMILES | COC[C@H](OC)[C@H](OC)[C@H](O[C@H]1O[C@H](C(=O)OC)[C@@H](OC)[C@H](OC)[C@H]1OC)[C@@H](COC)OC |
| InChI | InChI=1S/C21H40O12/c1-23-10-12(25-3)14(27-5)15(13(26-4)11-24-2)32-21-19(30-8)17(29-7)16(28-6)18(33-21)20(22)31-9/h12-19,21H,10-11H2,1-9H3/t12-,13+,14-,15+,16-,17-,18-,19+,21-/m0/s1 |
| InChIKey | UCQXKJDCJWCPDC-ICZXOEEOSA-N |
| XLogP | -0.35 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |