C22H32O5 — CID 162888562
methyl (3R,3aR,6E,10Z,13E,15aS)-3-(methoxymethyl)-6,14-dimethyl-2-oxo-3a,4,5,8,9,12,15,15a-octahydro-3H-cyclotetradeca[b]furan-10-carboxylate (PubChem CID 162888562) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is methyl (3R,3aR,6E,10Z,13E,15aS)-3-(methoxymethyl)-6,14-dimethyl-2-oxo-3a,4,5,8,9,12,15,15a-octahydro-3H-cyclotetradeca[b]furan-10-carboxylate.
| Compound Name | methyl (3R,3aR,6E,10Z,13E,15aS)-3-(methoxymethyl)-6,14-dimethyl-2-oxo-3a,4,5,8,9,12,15,15a-octahydro-3H-cyclotetradeca[b]furan-10-carboxylate |
|---|---|
| PubChem CID | 162888562 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (3R,3aR,6E,10Z,13E,15aS)-3-(methoxymethyl)-6,14-dimethyl-2-oxo-3a,4,5,8,9,12,15,15a-octahydro-3H-cyclotetradeca[b]furan-10-carboxylate |
| SMILES | COC[C@@H]1C(=O)O[C@H]2C/C(C)=C/C/C=C(\C(=O)OC)CC/C=C(\C)CC[C@@H]21 |
| InChI | InChI=1S/C22H32O5/c1-15-7-5-9-17(21(23)26-4)10-6-8-16(2)13-20-18(12-11-15)19(14-25-3)22(24)27-20/h7-8,10,18-20H,5-6,9,11-14H2,1-4H3/b15-7+,16-8+,17-10-/t18-,19+,20+/m1/s1 |
| InChIKey | BNSYBIBYECIBTQ-XMGFYUGLSA-N |
| XLogP | 4.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|