About (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane
(2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane (PubChem CID 162888683) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane.
Molecular Properties
| Compound Name | (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane |
| PubChem CID | 162888683 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane |
| SMILES | C=C[C@]1(C)CC[C@@H](/C(C)=C/CC=C(C)C)O1 |
| InChI | InChI=1S/C15H24O/c1-6-15(5)11-10-14(16-15)13(4)9-7-8-12(2)3/h6,8-9,14H,1,7,10-11H2,2-5H3/b13-9+/t14-,15+/m0/s1 |
| InChIKey | SADCLHOFZYXXAL-WMHHWXMBSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane?
The IUPAC name of (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane (CID 162888683) is (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane.
What is the SMILES notation for (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane?
The canonical SMILES for (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane is C=C[C@]1(C)CC[C@@H](/C(C)=C/CC=C(C)C)O1.
What is the InChIKey of (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane?
The InChIKey is SADCLHOFZYXXAL-WMHHWXMBSA-N. The full InChI is InChI=1S/C15H24O/c1-6-15(5)11-10-14(16-15)13(4)9-7-8-12(2)3/h6,8-9,14H,1,7,10-11H2,2-5H3/b13-9+/t14-,15+/m0/s1.
What are the key properties of (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane?
(2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane has a molecular weight of 220.36 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2-ethenyl-2-methyl-5-[(2E)-6-methylhepta-2,5-dien-2-yl]oxolane is sourced from PubChem (CID 162888683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).