About 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one
9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one (PubChem CID 162888730) has the molecular formula C15H12O5
and a molecular weight of 272.26 g/mol. Its IUPAC name is 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one |
| PubChem CID | 162888730 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one |
| SMILES | CC1(C)O[C@H]1Oc1c2occc2cc2ccc(=O)oc12 |
| InChI | InChI=1S/C15H12O5/c1-15(2)14(20-15)19-13-11-9(5-6-17-11)7-8-3-4-10(16)18-12(8)13/h3-7,14H,1-2H3/t14-/m1/s1 |
| InChIKey | SRSMIPIWBAUBCJ-CQSZACIVSA-N |
| XLogP | 3.05 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one?
The IUPAC name of 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one (CID 162888730) is 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one?
The canonical SMILES for 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one is CC1(C)O[C@H]1Oc1c2occc2cc2ccc(=O)oc12.
What is the InChIKey of 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one?
The InChIKey is SRSMIPIWBAUBCJ-CQSZACIVSA-N. The full InChI is InChI=1S/C15H12O5/c1-15(2)14(20-15)19-13-11-9(5-6-17-11)7-8-3-4-10(16)18-12(8)13/h3-7,14H,1-2H3/t14-/m1/s1.
What are the key properties of 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one?
9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one has a molecular weight of 272.26 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2S)-3,3-dimethyloxiran-2-yl]oxyfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 162888730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).